ULM-1(MDK7526; (S,R,S)-AHPC; Protein degrader 1)
$200.00
CAS No.: 1448297-52-6
Catalog No.: 133776
Purity: 95%
MF: C22H30N4O3S
MW: 430.574
Storage: 2-8 degree Celsius
SMILES: CC1=C(SC=N1)C1=CC=C(CNC(=O)[C@@H]2C[C@@H](O)CN2C(=O)[C@@H](N)C(C)(C)C)C=C1
Catalog No.: 133776
Purity: 95%
MF: C22H30N4O3S
MW: 430.574
Storage: 2-8 degree Celsius
SMILES: CC1=C(SC=N1)C1=CC=C(CNC(=O)[C@@H]2C[C@@H](O)CN2C(=O)[C@@H](N)C(C)(C)C)C=C1
(2S,4R)-1-((S)-2-amino-3,3-dimethylbutanoyl)-4-hydroxy-N-(4-(4-methylthiazol-5-yl)benzyl)pyrrolidine-2-carboxamide,CAS No.: 1448297-52-6; ChemShuttle, a renowned custom synthesis company, is dedicated to producing bioactive compounds. These compounds play a vital role in the study of biological processes and the development of therapeutic agents. Our bioactive compounds are designed to interact with specific biological targets, providing valuable insights and potential treatments for various diseases.
Reviews
Write Your Own Review