tert-butyl 5-bromo-3-(hydroxymethyl)-1H-indole-1-carboxylate
$200.00
CAS No.: 905710-14-7
Catalog No.: 137135
Purity: 95%
MF: C14H16BrNO3
MW: 326.19
Storage: 2-8 degree Celsius
SMILES: CC(C)(C)OC(=O)N1C=C(CO)C2=CC(Br)=CC=C12
Catalog No.: 137135
Purity: 95%
MF: C14H16BrNO3
MW: 326.19
Storage: 2-8 degree Celsius
SMILES: CC(C)(C)OC(=O)N1C=C(CO)C2=CC(Br)=CC=C12
tert-butyl 5-bromo-3-(hydroxymethyl)-1H-indole-1-carboxylate; CAS No.: 905710-14-7; ChemShuttle functions as a chemical synthesis company specializing in brominated hydroxymethyl indole derivatives such as tert-butyl 5-bromo-3-(hydroxymethyl)-1H-indole-1-carboxylate (CAS No.: 905710-14-7). This compound exemplifies the company's focus on offering building blocks for drug discovery with bromo and hydroxymethyl groups. As a chemical synthesis company, ChemShuttle offers various organic chemicals that serve as essential intermediates in pharmaceutical research. The bromo and hydroxymethyl groups in CAS No.: 905710-14-7 add to its structural diversity, making it valuable in custom synthesis projects. Researchers benefit from ChemShuttle's chemical synthesis company services when sourcing such specialized screening compounds, which are often critical for advancing drug discovery initiatives. The company's expertise in chemical synthesis ensures that compounds like this indole derivative meet the high standards required for research applications.
Reviews
Write Your Own Review