(S)-N,N-dimethyl-3-(naphthalen-1-yloxy)-3-(thiophen-2-yl)propan-1-amine oxalate
$250.00
CAS No.: 132335-47-8
Catalog No.: 137675
Purity: 95%
MF: C21H23NO5S
MW: 401.484
Storage: 2-8 degree Celsius
SMILES: OC(=O)C(O)=O.CN(C)CC[C@H](OC1=C2C=CC=CC2=CC=C1)C1=CC=CS1
Catalog No.: 137675
Purity: 95%
MF: C21H23NO5S
MW: 401.484
Storage: 2-8 degree Celsius
SMILES: OC(=O)C(O)=O.CN(C)CC[C@H](OC1=C2C=CC=CC2=CC=C1)C1=CC=CS1
(S)-N,N-dimethyl-3-(naphthalen-1-yloxy)-3-(thiophen-2-yl)propan-1-amine oxalate; CAS No.: 132335-47-8; (S)-N,N-dimethyl-3-(naphthalen-1-yloxy)-3-(thiophen-2-yl)propan-1-amine oxalate is a specialty chemical offered by ChemShuttle, a leading custom chemical synthesis company. As part of their extensive library of compounds, this stereospecific thiophene amine oxalate serves as a valuable building block for drug discovery. ChemShuttle's expertise in chemical building blocks allows them to provide high-purity (S)-N,N-dimethyl-3-(naphthalen-1-yloxy)-3-(thiophen-2-yl)propan-1-amine oxalate (CAS No.: 132335-47-8) with exact specifications. Their custom synthesis services ensure that researchers can obtain this CAS No.: 132335-47-8 compound for various organic chemistry applications, knowing it meets stringent quality standards. The company's role as a worldwide chemical supplier is further reinforced by their ability to deliver such specialized building blocks, essential for advancing pharmaceutical and chemical research. ChemShuttle's commitment to blocks chemistry underscores their position as a reliable provider of key intermediates in the scientific community.
Reviews
Write Your Own Review