GLP-1R agonist DMB; GLP-1R agonist DMB-DMB
$300.00
CAS No.: 281209-71-0
Catalog No.: 113683
Purity: 95%
MF: C13H15Cl2N3O2S
MW: 348.255
Storage: 2-8 degree Celsius
SMILES: CC(C)(C)NC1=NC2=CC(Cl)=C(Cl)C=C2N=C1S(C)(=O)=O
Catalog No.: 113683
Purity: 95%
MF: C13H15Cl2N3O2S
MW: 348.255
Storage: 2-8 degree Celsius
SMILES: CC(C)(C)NC1=NC2=CC(Cl)=C(Cl)C=C2N=C1S(C)(=O)=O
N-(tert-butyl)-6,7-dichloro-3-(methylsulfonyl)quinoxalin-2-amine,CAS No.: 281209-71-0; Specializing in cycle compounds, ChemShuttle is a trusted custom synthesis company. Our cycle compounds are integral to the development of complex molecular structures, offering stability and versatility in various chemical reactions. We provide high-quality cycle compounds that are essential for advancing research in organic chemistry and material science.
Reviews
Write Your Own Review