Dolutegravir Sodium; GSK-1349572A
$150.00
CAS No.: 1051375-19-9
Catalog No.: 158439
Purity: 95%
MF: C20H18F2N3NaO5
MW: 441.366
Storage: 2-8 degree Celsius
SMILES: [Na+].[H][C@]12CN3C=C(C(=O)NCC4=CC=C(F)C=C4F)C(=O)C([O-])=C3C(=O)N1[C@H](C)CCO2
Catalog No.: 158439
Purity: 95%
MF: C20H18F2N3NaO5
MW: 441.366
Storage: 2-8 degree Celsius
SMILES: [Na+].[H][C@]12CN3C=C(C(=O)NCC4=CC=C(F)C=C4F)C(=O)C([O-])=C3C(=O)N1[C@H](C)CCO2
sodium (4R,12aS)-9-((2,4-difluorobenzyl)carbamoyl)-4-methyl-6,8-dioxo-3,4,6,8,12,12a-hexahydro-2H-pyrido[1',2':4,5]pyrazino[2,1-b][1,3]oxazin-7-olate,CAS No.: 1339953-58-0 This substance is characterized by its specific chemical behavior and is used in the production of specialty chemicals. Its applications include the synthesis of complex organic molecules for various industrial uses.
Reviews
Write Your Own Review