Montelukast
$200.00
CAS No.: 158966-92-8
Catalog No.: 190933
Purity: 95%
MF: C35H36ClNO3S
MW: 586.197
Storage: 2-8 degree Celsius
SMILES: ClC1=CC=C2C=CC(=NC2=C1)/C=C/C=1C=C(C=CC1)[C@@H](CCC1=C(C=CC=C1)C(C)(C)O)SCC1(CC1)CC(=O)O
Catalog No.: 190933
Purity: 95%
MF: C35H36ClNO3S
MW: 586.197
Storage: 2-8 degree Celsius
SMILES: ClC1=CC=C2C=CC(=NC2=C1)/C=C/C=1C=C(C=CC1)[C@@H](CCC1=C(C=CC=C1)C(C)(C)O)SCC1(CC1)CC(=O)O
(R,E)-2-(1-(((1-(3-(2-(7-chloroquinolin-2-yl)vinyl)phenyl)-3-(2-(2-hydroxypropan-2-yl)phenyl)propyl)thio)methyl)cyclopropyl)acetic acid; CAS No.: 158966-92-8 - This compound is a critical component in the synthesis of complex organic molecules, particularly in pharmaceutical research. Its unique properties facilitate the development of new drugs. ChemShuttle's extensive inventory and streamlined purchasing process ensure that researchers can easily obtain the compounds they need.
Reviews
Write Your Own Review