Miconazole Nitrate
$150.00
CAS No.: 22832-87-7
Catalog No.: 151545
Purity: 95%
MF: C18H14Cl4N3O4-
MW: 478.139
Storage: 2-8 degree Celsius
SMILES: [O-][N+]([O-])=O.ClC1=CC(Cl)=C(COC(CN2C=CN=C2)C2=C(Cl)C=C(Cl)C=C2)C=C1
Catalog No.: 151545
Purity: 95%
MF: C18H14Cl4N3O4-
MW: 478.139
Storage: 2-8 degree Celsius
SMILES: [O-][N+]([O-])=O.ClC1=CC(Cl)=C(COC(CN2C=CN=C2)C2=C(Cl)C=C(Cl)C=C2)C=C1
1-(2-((2,4-dichlorobenzyl)oxy)-2-(2,4-dichlorophenyl)ethyl)-1H-imidazole nitrate; CAS No.: 92815-50-4 This chemical is utilized in the pharmaceutical sector due to its specific molecular structure and reactivity. It is involved in the synthesis of therapeutic agents, contributing to advancements in medical treatments.
Reviews
Write Your Own Review