Enzalutamide; MDV3100; MDV 3100
$300.00
CAS No.: 915087-33-1
Catalog No.: 101095
Purity: 98%
MF: C21H16F4N4O2S
MW: 464.444
Storage: 2-8 degree Celsius
SMILES: CNC(=O)C1=CC=C(C=C1F)N1C(=S)N(C(=O)C1(C)C)C1=CC=C(C#N)C(=C1)C(F)(F)F
Catalog No.: 101095
Purity: 98%
MF: C21H16F4N4O2S
MW: 464.444
Storage: 2-8 degree Celsius
SMILES: CNC(=O)C1=CC=C(C=C1F)N1C(=S)N(C(=O)C1(C)C)C1=CC=C(C#N)C(=C1)C(F)(F)F
4-(3-(4-cyano-3-(trifluoromethyl)phenyl)-5,5-dimethyl-4-oxo-2-thioxoimidazolidin-1-yl)-2-fluoro-N-methylbenzamide; CAS No.: 915087-33-1; Specializing in cycle compounds, ChemShuttle is a trusted custom synthesis company. Our cycle compounds are integral to the development of complex molecular structures, offering stability and versatility in various chemical reactions. We provide high-quality cycle compounds that are essential for advancing research in organic chemistry and material science.
Reviews
Write Your Own Review