Griseofulvin
$300.00
CAS No.: 126-07-8
Catalog No.: 151865
Purity: 95%
MF: C17H19ClO6
MW: 354.786
Storage: 2-8 degree Celsius
SMILES: COC1CC(=O)C[C@@H](C)[C@]11OC2=C(Cl)C(OC)=CC(OC)=C2C1=O
Catalog No.: 151865
Purity: 95%
MF: C17H19ClO6
MW: 354.786
Storage: 2-8 degree Celsius
SMILES: COC1CC(=O)C[C@@H](C)[C@]11OC2=C(Cl)C(OC)=CC(OC)=C2C1=O
(2S,6'R)-7-chloro-2',4,6-trimethoxy-6'-methyl-3H-spiro[benzofuran-2,1'-cyclohexane]-3,4'-dione,CAS No.: 126-07-8 - A novel compound with potential applications in the development of new drugs, particularly in targeting specific pathways or mechanisms. ChemShuttle's focus on innovative bioactive compounds ensures access to cutting-edge research materials.
Reviews
Write Your Own Review