Oseltamivir Phosphate
$200.00
CAS No.: 204255-11-8
Catalog No.: 141595
Purity: 95%
MF: C16H31N2O8P
MW: 410.404
Storage: 2-8 degree Celsius
SMILES: OP(O)(O)=O.CCOC(=O)C1=C[C@@H](OC(CC)CC)[C@H](NC(C)=O)[C@@H](N)C1
Catalog No.: 141595
Purity: 95%
MF: C16H31N2O8P
MW: 410.404
Storage: 2-8 degree Celsius
SMILES: OP(O)(O)=O.CCOC(=O)C1=C[C@@H](OC(CC)CC)[C@H](NC(C)=O)[C@@H](N)C1
ethyl (3R,4R,5S)-4-acetamido-5-amino-3-(1-ethylpropoxy)-1-cyclohexene-1-carboxylate phosphate; CAS No.: 204255-11-8 - A specialized building block used in the synthesis of complex organic molecules, particularly in the field of drug discovery. Its unique chemical properties facilitate the creation of diverse molecular structures. ChemShuttle's commitment to providing a wide range of chemical products supports innovative research.
Reviews
Write Your Own Review