![2-(4-bromophenyl)-5,8-dioxaspiro[3.4]octan-2-amine](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/0/100140_2.jpg)
methyl 4-(2-methoxy-2-oxoethyl)-3-nitrobenzoate
$200.00
CAS No.: 334952-07-7
Catalog No.: 100155
Purity: 80%
MF: C11H11NO6
MW: 253.21
Storage: 2-8 degree Celsius
SMILES: COC(=O)CC1=CC=C(C=C1[N+]([O-])=O)C(=O)OC
Catalog No.: 100155
Purity: 80%
MF: C11H11NO6
MW: 253.21
Storage: 2-8 degree Celsius
SMILES: COC(=O)CC1=CC=C(C=C1[N+]([O-])=O)C(=O)OC
methyl 4-(2-methoxy-2-oxoethyl)-3-nitrobenzoate,CAS No.: 334952-07-7 A key ingredient in pharmaceutical formulations, this compound is known for its stability and efficacy. ChemShuttle s local development and US warehouse ensure consistent quality and fast delivery.
Reviews
Write Your Own Review