HhAntag HCl
$300.00
CAS No.: 2740397-08-2
Catalog No.: 187665
Purity: 95%
MF: C24H24Cl2N4O3
MW: 487.387
Storage: 2-8 degree Celsius
SMILES: Cl.ClC1=C(C=C(C=C1)NC(C1=CC(=CC(=C1)OC)OC)=O)C1=NC2=C(N1)C=CC(=C2)N(C)C
Catalog No.: 187665
Purity: 95%
MF: C24H24Cl2N4O3
MW: 487.387
Storage: 2-8 degree Celsius
SMILES: Cl.ClC1=C(C=C(C=C1)NC(C1=CC(=CC(=C1)OC)OC)=O)C1=NC2=C(N1)C=CC(=C2)N(C)C
N-(4-chloro-3-(5-(dimethylamino)-1H-benzo[d]imidazol-2-yl)phenyl)-3,5-dimethoxybenzamide hydrochloride,CAS No.: 71306-36-0 Known for its unique molecular structure, this compound is utilized in the development of high-performance materials. Its applications include advanced composites and materials with enhanced properties.
Reviews
Write Your Own Review