![(3aR,6aR)-2,2-dimethyl-hexahydrocyclopenta[d][1,3]dioxol-4-one](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/7/170160_1.jpg)
cis-4-(acetyloxy)cyclopent-2-en-1-yl acetate
$200.00
CAS No.: 54664-61-8
Catalog No.: 170203
Purity: 95%
MF: C9H12O4
MW: 184.191
Storage: 2-8 degree Celsius
SMILES: CC(=O)O[C@@H]1C[C@H](OC(C)=O)C=C1
Catalog No.: 170203
Purity: 95%
MF: C9H12O4
MW: 184.191
Storage: 2-8 degree Celsius
SMILES: CC(=O)O[C@@H]1C[C@H](OC(C)=O)C=C1
cis-4-(acetyloxy)cyclopent-2-en-1-yl acetate; CAS No.: 54664-61-8; cis-4-(acetyloxy)cyclopent-2-en-1-yl acetate highlights ChemShuttle's cycle compounds selection. As a chemical synthesis company, we provide oxygenated cyclopentene derivatives for research applications. This compound features a cis-acetyloxy group on a cyclopentene ring with an acetate ester, offering interesting electronic properties. ChemShuttle's Small molecules synthesis capabilities ensure precise substitution and high purity. The ester and acetyloxy groups provide additional reactivity, making this compound valuable in organic synthesis and materials science.
Reviews
Write Your Own Review