Celecoxib; Celebra; Celebrex; SC 58635
$300.00
CAS No.: 169590-42-5
Catalog No.: 112408
Purity: 95%
MF: C17H14F3N3O2S
MW: 381.379
Storage: 2-8 degree Celsius
SMILES: CC1=CC=C(C=C1)C1=CC(=NN1C1=CC=C(C=C1)S(N)(=O)=O)C(F)(F)F
Catalog No.: 112408
Purity: 95%
MF: C17H14F3N3O2S
MW: 381.379
Storage: 2-8 degree Celsius
SMILES: CC1=CC=C(C=C1)C1=CC(=NN1C1=CC=C(C=C1)S(N)(=O)=O)C(F)(F)F
4-(5-(p-tolyl)-3-(trifluoromethyl)-1H-pyrazol-1-yl)benzenesulfonamide,CAS No.: 169590-42-5 This chemical is known for its specific reactivity and stability under various conditions. It is primarily used in the pharmaceutical industry as a building block for the synthesis of complex drug molecules.
Reviews
Write Your Own Review