![(1R,5S,6s)-3-benzyl-3-azabicyclo[3.1.0]hexan-6-amine](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/1/113907_2.jpg)
tert-butyl (1R,5S,6s)-3-azabicyclo[3.1.0]hexan-6-ylcarbamate
$200.00
CAS No.: 134575-17-0
Catalog No.: 113909
Purity: 95%
MF: C10H18N2O2
MW: 198.266
Storage: 2-8 degree Celsius
SMILES: [H][C@@]12CNC[C@]1([H])[C@H]2NC(=O)OC(C)(C)C
Catalog No.: 113909
Purity: 95%
MF: C10H18N2O2
MW: 198.266
Storage: 2-8 degree Celsius
SMILES: [H][C@@]12CNC[C@]1([H])[C@H]2NC(=O)OC(C)(C)C
tert-butyl (1R,5S,6s)-3-azabicyclo[3.1.0]hexan-6-ylcarbamate; CAS No.: 134575-17-0 A key component in pharmaceutical research, this chemical is known for its safety and efficacy. ChemShuttle s local R&D and US warehouse ensure consistent quality and timely delivery.
Reviews
Write Your Own Review