![tert-butyl N-(5-bromo-3-ethynylpyrazin-2-yl)-N-[(tert-butoxy)carbonyl]carbamate](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/3/133191_4.jpg)
6-chloro-3-(2,3-dichlorophenyl)pyrazin-2-amine
$250.00
CAS No.: 212779-33-4
Catalog No.: 133305
Purity: 95%
MF: C10H6Cl3N3
MW: 274.538
Storage: 2-8 degree Celsius
SMILES: NC1=C(N=CC(Cl)=N1)C1=C(Cl)C(Cl)=CC=C1
Catalog No.: 133305
Purity: 95%
MF: C10H6Cl3N3
MW: 274.538
Storage: 2-8 degree Celsius
SMILES: NC1=C(N=CC(Cl)=N1)C1=C(Cl)C(Cl)=CC=C1
6-chloro-3-(2,3-dichlorophenyl)pyrazin-2-amine; CAS No.: 212779-33-4: This substance is employed in the development of advanced materials. Its physical properties, such as its high surface area, make it suitable for use in catalysts and other high-performance materials.
Reviews
Write Your Own Review