TCFH
$200.00
CAS No.: 94790-35-9
Catalog No.: 143911
Purity: 95%
MF: C5H12ClF6N2P
MW: 280.58
Storage: 2-8 degree Celsius
SMILES: F[P-](F)(F)(F)(F)F.CN(C)C(Cl)=[N+](C)C
Catalog No.: 143911
Purity: 95%
MF: C5H12ClF6N2P
MW: 280.58
Storage: 2-8 degree Celsius
SMILES: F[P-](F)(F)(F)(F)F.CN(C)C(Cl)=[N+](C)C
N-(chloro(dimethylamino)methylene)-N-methylmethanaminium hexafluorophosphate(V),CAS No.: 94790-35-9 - This bioactive compound is utilized in the synthesis of therapeutic agents, offering potential benefits in treating various diseases. ChemShuttle's commitment to providing high-quality bioactive compounds enhances its value in pharmaceutical research.
Reviews
Write Your Own Review