![methyl 5-hydroxybenzo[b]thiophene-2-carboxylate](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/2/126008_1.jpg)
![5-fluorobenzo[b]thiophen-2-ylboronic acid](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/2/126057_2.jpg)
5-methoxybenzo[b]thiophene-2-carboxylic acid
$200.00
CAS No.: 23046-02-8
Catalog No.: 126010
Purity: 95%
MF: C10H8O3S
MW: 208.238
Storage: 2-8 degree Celsius
SMILES: COC1=CC=C2SC(=CC2=C1)C(O)=O
Catalog No.: 126010
Purity: 95%
MF: C10H8O3S
MW: 208.238
Storage: 2-8 degree Celsius
SMILES: COC1=CC=C2SC(=CC2=C1)C(O)=O
5-methoxybenzo[b]thiophene-2-carboxylic acid; CAS No.: 23046-02-8; ChemShuttle, a leading chemicals distributor and chemical online store, offers a wide array of chemical building blocks and cycle compounds. As a chemical synthesis company, ChemShuttle specializes in custom synthesis and CRO chemical synthesis, providing various organic chemicals and key intermediates. The 5-methoxybenzo[b]thiophene-2-carboxylic acid is an example of a heterocycle that serves as a building block for drug discovery. These compounds are crucial for pharma building blocks and blocks chemistry, facilitating the development of new pharmaceuticals and materials. ChemShuttle's library of compounds includes this specific molecule, along with other chem blocks, making it a valuable resource for researchers and developers in the chemical and pharmaceutical industries. With its expertise in custom compound synthesis, ChemShuttle ensures the availability of high-quality chemicals to support innovative projects.
Reviews
Write Your Own Review