![5-nitrobenzo[d]oxazole-2(3H)-thione](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/5/158918_1.jpg)
![5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[d]oxazole](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/7/178039_2.jpg)
5-fluoro-1,3-benzoxazole-2-carboxylic acid
$400.00
CAS No.: 944898-49-1
Catalog No.: 162875
Purity: 95%
MF: C8H4FNO3
MW: 181.122
Storage: 2-8 degree Celsius
SMILES: OC(=O)C1=NC2=C(O1)C=CC(F)=C2
Catalog No.: 162875
Purity: 95%
MF: C8H4FNO3
MW: 181.122
Storage: 2-8 degree Celsius
SMILES: OC(=O)C1=NC2=C(O1)C=CC(F)=C2
5-fluoro-1,3-benzoxazole-2-carboxylic acid; CAS No.: 944898-49-1; 5-fluoro-1,3-benzoxazole-2-carboxylic acid is part of ChemShuttle's collection of various organic chemicals, which are used extensively in chemical research and synthesis. As a various organic chemical with unique structural features, this compound highlights the company's ability to supply specialized building blocks for the development of new pharmaceuticals. The various organic chemicals offered by ChemShuttle, including 5-fluoro-1,3-benzoxazole-2-carboxylic acid (CAS No.: 944898-49-1), are essential for enabling researchers to construct complex molecules with potential therapeutic applications. These various organic chemicals serve as the foundation for numerous custom synthesis projects, facilitating the exploration of new chemical spaces in the quest for potential drug candidates. By supplying a diverse array of various organic chemicals, ChemShuttle ensures that scientists have access to the necessary components to advance their research. The 5-fluoro-1,3-benzoxazole-2-carboxylic acid (CAS No.: 944898-49-1) exemplifies the company's dedication to providing high-quality building blocks that contribute to innovation in chemical synthesis.
Reviews
Write Your Own Review