![2-methyl-3-oxo-2,3-dihydro-1H-pyrazolo[4,3-c]pyridine-7-carboxylic acid](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/3/134695_2.jpg)
4-methoxy-5-nitropyridin-2(1H)-one
$100.00
CAS No.: 607373-82-0
Catalog No.: 134630
Purity: 95%
MF: C6H6N2O4
MW: 170.124
Storage: 2-8 degree Celsius
SMILES: COC1=CC(=O)NC=C1[N+]([O-])=O
Catalog No.: 134630
Purity: 95%
MF: C6H6N2O4
MW: 170.124
Storage: 2-8 degree Celsius
SMILES: COC1=CC(=O)NC=C1[N+]([O-])=O
4-methoxy-5-nitropyridin-2(1H)-one,CAS No.: 607373-82-0 A key component in pharmaceutical research, this chemical is known for its safety and efficacy. ChemShuttle s local expertise and US inventory ensure reliable access and support.
Reviews
Write Your Own Review