![trans-7-methyl-1,4-dioxaspiro[4.5]decan-8-ol](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/8/185055_3.jpg)
1-(fluorosulfonyl)-2,3-dimethyl-1H-imidazol-3-ium trifluoromethanesulfonate
$150.00
CAS No.: 2179072-33-2
Catalog No.: 185051
Purity: 95%
MF: C6H8F4N2O5S2
MW: 328.265
Storage: -20 degree Celsius
SMILES: [O-]S(=O)(=O)C(F)(F)F.CC1=[N+](C)C=CN1S(F)(=O)=O
Catalog No.: 185051
Purity: 95%
MF: C6H8F4N2O5S2
MW: 328.265
Storage: -20 degree Celsius
SMILES: [O-]S(=O)(=O)C(F)(F)F.CC1=[N+](C)C=CN1S(F)(=O)=O
CAS NO.: 2179072-33-2; 1-(Fluorosulfonyl)-2,3-dimethyl-1H-imidazol-3-ium trifluoromethanesulfonate. PROPERTIES: 1-(Fluorosulfonyl)-2,3-dimethyl-1H-imidazol-3-ium trifluoromethanesulfonate has a complex chemical structure. It is an ionic compound. As an ionic species, it may have relatively good solubility in polar solvents such as water or polar organic solvents. It is important to store it in a tightly sealed container in a dry environment to prevent hydrolysis or reaction with moisture in the air. Safety precautions include avoiding contact with skin and eyes as it may cause irritation. Inhalation of its dust or vapor should also be avoided. APPLICATIONS: This compound can be utilized in organic synthesis as a reagent. It may participate in reactions to introduce specific functional groups or modify the structure of other organic compounds. For example, in some synthetic routes where the introduction of a fluorosulfonyl group or the use of the imidazolium ion as a reaction intermediate is required, this compound can play a crucial role. Its application in synthetic chemistry is based on the principles and requirements of various organic synthesis reactions as described in relevant organic chemistry literature.
Reviews
Write Your Own Review