1,2-dimethyl 3-bromobenzene-1,2-dicarboxylate
$295.00
CAS No.: 58749-33-0
Catalog No.: 170164
Purity: 95%
MF: C10H9BrO4
MW: 273.082
Storage: 2-8 degree Celsius
SMILES: COC(=O)C1=C(C(=O)OC)C(Br)=CC=C1
Catalog No.: 170164
Purity: 95%
MF: C10H9BrO4
MW: 273.082
Storage: 2-8 degree Celsius
SMILES: COC(=O)C1=C(C(=O)OC)C(Br)=CC=C1
1,2-dimethyl 3-bromobenzene-1,2-dicarboxylate; CAS No.: 58749-33-0; 1,2-dimethyl 3-bromobenzene-1,2-dicarboxylate represents ChemShuttle's building blocks for drug discovery. As a custom synthesis company, we specialize in brominated aromatic compounds for medicinal chemistry. This dicarboxylate derivative features a brominated benzene core with methyl ester groups, providing versatile functionality for further modification. ChemShuttle's chemical synthesis expertise ensures precise substitution and high purity. The compound serves as a valuable intermediate for creating more complex aromatic systems in drug development projects.
Reviews
Write Your Own Review