1,2-bis(bromomethyl)-3-nitrobenzene
$150.00
CAS No.: 66126-16-7
Catalog No.: 105097
Purity: 95%
MF: C8H7Br2NO2
MW: 308.957
Storage: 2-8 degree Celsius
SMILES: [O-][N+](=O)C1=C(CBr)C(CBr)=CC=C1
Catalog No.: 105097
Purity: 95%
MF: C8H7Br2NO2
MW: 308.957
Storage: 2-8 degree Celsius
SMILES: [O-][N+](=O)C1=C(CBr)C(CBr)=CC=C1
1,2-bis(bromomethyl)-3-nitrobenzene; CAS No.: 66126-16-7; Essential for the synthesis of complex bioactive molecules, this chemical is renowned for its purity and effectiveness. It plays a significant role in the development of new therapeutic agents. ChemShuttle offers this product, ensuring quick access and delivery from US warehouses.
Reviews
Write Your Own Review